C15H13F3OS — CID 106848363
(4-ethylsulfanylphenyl)-(2,3,4-trifluorophenyl)methanol (PubChem CID 106848363) has the molecular formula C15H13F3OS and a molecular weight of 298.33 g/mol. Its IUPAC name is (4-ethylsulfanylphenyl)-(2,3,4-trifluorophenyl)methanol.
| Compound Name | (4-ethylsulfanylphenyl)-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 106848363 |
| Molecular Formula | C15H13F3OS |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (4-ethylsulfanylphenyl)-(2,3,4-trifluorophenyl)methanol |
| SMILES | CCSc1ccc(C(O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H13F3OS/c1-2-20-10-5-3-9(4-6-10)15(19)11-7-8-12(16)14(18)13(11)17/h3-8,15,19H,2H2,1H3 |
| InChIKey | CKNQIXZKYMLMHT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|