C15H14F2OS — CID 106848139
(3,5-difluorophenyl)-(4-ethylsulfanylphenyl)methanol (PubChem CID 106848139) has the molecular formula C15H14F2OS and a molecular weight of 280.34 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(4-ethylsulfanylphenyl)methanol.
| Compound Name | (3,5-difluorophenyl)-(4-ethylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 106848139 |
| Molecular Formula | C15H14F2OS |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (3,5-difluorophenyl)-(4-ethylsulfanylphenyl)methanol |
| SMILES | CCSc1ccc(C(O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H14F2OS/c1-2-19-14-5-3-10(4-6-14)15(18)11-7-12(16)9-13(17)8-11/h3-9,15,18H,2H2,1H3 |
| InChIKey | YFYDFVPXDSHCCX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |