C16H20BrN3S — CID 106849549
5-bromo-2-(4-ethylsulfanylphenyl)-6-methyl-N-propylpyrimidin-4-amine (PubChem CID 106849549) has the molecular formula C16H20BrN3S and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-bromo-2-(4-ethylsulfanylphenyl)-6-methyl-N-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-ethylsulfanylphenyl)-6-methyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106849549 |
| Molecular Formula | C16H20BrN3S |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 5-bromo-2-(4-ethylsulfanylphenyl)-6-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2ccc(SCC)cc2)nc(C)c1Br |
| InChI | InChI=1S/C16H20BrN3S/c1-4-10-18-16-14(17)11(3)19-15(20-16)12-6-8-13(9-7-12)21-5-2/h6-9H,4-5,10H2,1-3H3,(H,18,19,20) |
| InChIKey | GTPDRZAFZICWPQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |