C9H14BrN3 — CID 66304687
5-bromo-2,6-dimethyl-N-propylpyrimidin-4-amine (PubChem CID 66304687) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is 5-bromo-2,6-dimethyl-N-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2,6-dimethyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66304687 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 5-bromo-2,6-dimethyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C)nc(C)c1Br |
| InChI | InChI=1S/C9H14BrN3/c1-4-5-11-9-8(10)6(2)12-7(3)13-9/h4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | YMZBUENUIKWOLK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |