C11H18BrN3 — CID 66307676
5-bromo-6-methyl-N,2-dipropylpyrimidin-4-amine (PubChem CID 66307676) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 5-bromo-6-methyl-N,2-dipropylpyrimidin-4-amine.
| Compound Name | 5-bromo-6-methyl-N,2-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66307676 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 5-bromo-6-methyl-N,2-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CCC)nc(C)c1Br |
| InChI | InChI=1S/C11H18BrN3/c1-4-6-9-14-8(3)10(12)11(15-9)13-7-5-2/h4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | FNYGKBYANXTMBL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |