C12H11BrN2O3 — CID 106850782
N-[(5-amino-2-hydroxyphenyl)methyl]-2-bromofuran-3-carboxamide (PubChem CID 106850782) has the molecular formula C12H11BrN2O3 and a molecular weight of 311.14 g/mol. Its IUPAC name is N-[(5-amino-2-hydroxyphenyl)methyl]-2-bromofuran-3-carboxamide.
| Compound Name | N-[(5-amino-2-hydroxyphenyl)methyl]-2-bromofuran-3-carboxamide |
|---|---|
| PubChem CID | 106850782 |
| Molecular Formula | C12H11BrN2O3 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | N-[(5-amino-2-hydroxyphenyl)methyl]-2-bromofuran-3-carboxamide |
| SMILES | Nc1ccc(O)c(CNC(=O)c2ccoc2Br)c1 |
| InChI | InChI=1S/C12H11BrN2O3/c13-11-9(3-4-18-11)12(17)15-6-7-5-8(14)1-2-10(7)16/h1-5,16H,6,14H2,(H,15,17) |
| InChIKey | GZMZBXOOPLADBW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|