C13H13N3O2 — CID 43548732
N-[(5-amino-2-hydroxyphenyl)methyl]pyridine-4-carboxamide (PubChem CID 43548732) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[(5-amino-2-hydroxyphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | N-[(5-amino-2-hydroxyphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 43548732 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[(5-amino-2-hydroxyphenyl)methyl]pyridine-4-carboxamide |
| SMILES | Nc1ccc(O)c(CNC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C13H13N3O2/c14-11-1-2-12(17)10(7-11)8-16-13(18)9-3-5-15-6-4-9/h1-7,17H,8,14H2,(H,16,18) |
| InChIKey | RQXBLJVNMUVUQD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|