C17H19N5 — CID 10685135
6-phenyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 10685135) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-phenyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-phenyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10685135 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 6-phenyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(N2CCCCC2)c2[nH]c(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C17H19N5/c18-17-20-14-11-13(12-7-3-1-4-8-12)19-15(14)16(21-17)22-9-5-2-6-10-22/h1,3-4,7-8,11,19H,2,5-6,9-10H2,(H2,18,20,21) |
| InChIKey | ZONXEKBVNGKTDS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |