About 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride
6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride (PubChem CID 162331783) has the molecular formula C20H25ClN4
and a molecular weight of 356.90 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride |
| PubChem CID | 162331783 |
| Molecular Formula | C20H25ClN4 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride |
| SMILES | Cc1nc(N2CCCCC2)c2[nH]c(-c3ccc(C)c(C)c3)cc2n1.Cl |
| InChI | InChI=1S/C20H24N4.ClH/c1-13-7-8-16(11-14(13)2)17-12-18-19(23-17)20(22-15(3)21-18)24-9-5-4-6-10-24;/h7-8,11-12,23H,4-6,9-10H2,1-3H3;1H |
| InChIKey | NAKFSETWWCQVGO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride?
The IUPAC name of 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride (CID 162331783) is 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride.
What is the SMILES notation for 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride?
The canonical SMILES for 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride is Cc1nc(N2CCCCC2)c2[nH]c(-c3ccc(C)c(C)c3)cc2n1.Cl.
What is the InChIKey of 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride?
The InChIKey is NAKFSETWWCQVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4.ClH/c1-13-7-8-16(11-14(13)2)17-12-18-19(23-17)20(22-15(3)21-18)24-9-5-4-6-10-24;/h7-8,11-12,23H,4-6,9-10H2,1-3H3;1H.
What are the key properties of 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride?
6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride has a molecular weight of 356.90 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylphenyl)-2-methyl-4-piperidin-1-yl-5H-pyrrolo[3,2-d]pyrimidine;hydrochloride is sourced from PubChem (CID 162331783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).