C17H19BrO2 — CID 106851399
(2-bromofuran-3-yl)-(2,4,6-triethylphenyl)methanone (PubChem CID 106851399) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(2,4,6-triethylphenyl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(2,4,6-triethylphenyl)methanone |
|---|---|
| PubChem CID | 106851399 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2-bromofuran-3-yl)-(2,4,6-triethylphenyl)methanone |
| SMILES | CCc1cc(CC)c(C(=O)c2ccoc2Br)c(CC)c1 |
| InChI | InChI=1S/C17H19BrO2/c1-4-11-9-12(5-2)15(13(6-3)10-11)16(19)14-7-8-20-17(14)18/h7-10H,4-6H2,1-3H3 |
| InChIKey | FNZPSUJRBFOAOP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |