C11H14BrNO3 — CID 106852656
(2-bromofuran-3-yl)-(2,2-dimethylmorpholin-4-yl)methanone (PubChem CID 106852656) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(2,2-dimethylmorpholin-4-yl)methanone.
| Compound Name | (2-bromofuran-3-yl)-(2,2-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 106852656 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2-bromofuran-3-yl)-(2,2-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccoc2Br)CCO1 |
| InChI | InChI=1S/C11H14BrNO3/c1-11(2)7-13(4-6-16-11)10(14)8-3-5-15-9(8)12/h3,5H,4,6-7H2,1-2H3 |
| InChIKey | MEPSRFGSLNTVKT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |