C10H14BrNO3 — CID 106854194
2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)furan-3-carboxamide (PubChem CID 106854194) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106854194 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-bromo-N-(3-hydroxy-2,2-dimethylpropyl)furan-3-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1ccoc1Br |
| InChI | InChI=1S/C10H14BrNO3/c1-10(2,6-13)5-12-9(14)7-3-4-15-8(7)11/h3-4,13H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | YNCXEWJQMZDXCN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |