C7H5BrN2O3 — CID 106854843
[5-(2-bromofuran-3-yl)-1,2,4-oxadiazol-3-yl]methanol (PubChem CID 106854843) has the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. Its IUPAC name is [5-(2-bromofuran-3-yl)-1,2,4-oxadiazol-3-yl]methanol.
| Compound Name | [5-(2-bromofuran-3-yl)-1,2,4-oxadiazol-3-yl]methanol |
|---|---|
| PubChem CID | 106854843 |
| Molecular Formula | C7H5BrN2O3 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | [5-(2-bromofuran-3-yl)-1,2,4-oxadiazol-3-yl]methanol |
| SMILES | OCc1noc(-c2ccoc2Br)n1 |
| InChI | InChI=1S/C7H5BrN2O3/c8-6-4(1-2-12-6)7-9-5(3-11)10-13-7/h1-2,11H,3H2 |
| InChIKey | UNTCSUJMONYLLC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |