About [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine
[5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 106855917) has the molecular formula C7H6BrN3O2
and a molecular weight of 244.05 g/mol. Its IUPAC name is [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine |
| PubChem CID | 106855917 |
| Molecular Formula | C7H6BrN3O2 |
| Molecular Weight | 244.05 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(-c2ccoc2Br)o1 |
| InChI | InChI=1S/C7H6BrN3O2/c8-6-4(1-2-12-6)7-11-10-5(3-9)13-7/h1-2H,3,9H2 |
| InChIKey | ZXDVUHFUDXFCHU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.05 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine?
The IUPAC name of [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine (CID 106855917) is [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine.
What is the SMILES notation for [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine?
The canonical SMILES for [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine is NCc1nnc(-c2ccoc2Br)o1.
What is the InChIKey of [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine?
The InChIKey is ZXDVUHFUDXFCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O2/c8-6-4(1-2-12-6)7-11-10-5(3-9)13-7/h1-2H,3,9H2.
What are the key properties of [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine?
[5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine has a molecular weight of 244.05 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-bromofuran-3-yl)-1,3,4-oxadiazol-2-yl]methanamine is sourced from PubChem (CID 106855917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).