C17H17BrN2O — CID 106858306
N-[(2-bromofuran-3-yl)-quinolin-5-ylmethyl]propan-1-amine (PubChem CID 106858306) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is N-[(2-bromofuran-3-yl)-quinolin-5-ylmethyl]propan-1-amine.
| Compound Name | N-[(2-bromofuran-3-yl)-quinolin-5-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 106858306 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[(2-bromofuran-3-yl)-quinolin-5-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1Br)c1cccc2ncccc12 |
| InChI | InChI=1S/C17H17BrN2O/c1-2-9-20-16(14-8-11-21-17(14)18)13-5-3-7-15-12(13)6-4-10-19-15/h3-8,10-11,16,20H,2,9H2,1H3 |
| InChIKey | BJSCZSWYBCXETK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |