C17H24N2O3 — CID 10685938
tert-butyl N-(4-cyanobutyl)-N-phenylmethoxycarbamate (PubChem CID 10685938) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-(4-cyanobutyl)-N-phenylmethoxycarbamate.
| Compound Name | tert-butyl N-(4-cyanobutyl)-N-phenylmethoxycarbamate |
|---|---|
| PubChem CID | 10685938 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-(4-cyanobutyl)-N-phenylmethoxycarbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCC#N)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(20)19(13-9-5-8-12-18)21-14-15-10-6-4-7-11-15/h4,6-7,10-11H,5,8-9,13-14H2,1-3H3 |
| InChIKey | PMFJIAMYWRXMHN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|