C14H17BrN2O2 — CID 106859886
[(2-bromofuran-3-yl)-(4-propoxyphenyl)methyl]hydrazine (PubChem CID 106859886) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is [(2-bromofuran-3-yl)-(4-propoxyphenyl)methyl]hydrazine.
| Compound Name | [(2-bromofuran-3-yl)-(4-propoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106859886 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [(2-bromofuran-3-yl)-(4-propoxyphenyl)methyl]hydrazine |
| SMILES | CCCOc1ccc(C(NN)c2ccoc2Br)cc1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-2-8-18-11-5-3-10(4-6-11)13(17-16)12-7-9-19-14(12)15/h3-7,9,13,17H,2,8,16H2,1H3 |
| InChIKey | AFCRBHDWLPRFJP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|