C13H15BrN2O3 — CID 106860090
[(2-bromofuran-3-yl)-(3,5-dimethoxyphenyl)methyl]hydrazine (PubChem CID 106860090) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is [(2-bromofuran-3-yl)-(3,5-dimethoxyphenyl)methyl]hydrazine.
| Compound Name | [(2-bromofuran-3-yl)-(3,5-dimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106860090 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | [(2-bromofuran-3-yl)-(3,5-dimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1cc(OC)cc(C(NN)c2ccoc2Br)c1 |
| InChI | InChI=1S/C13H15BrN2O3/c1-17-9-5-8(6-10(7-9)18-2)12(16-15)11-3-4-19-13(11)14/h3-7,12,16H,15H2,1-2H3 |
| InChIKey | DMVDHMFTOINOOD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|