C15H25N5O2 — CID 10686180
3-(13,14-dioxo-1,5,8,12-tetrazabicyclo[10.2.2]hexadecan-5-yl)propanenitrile (PubChem CID 10686180) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-(13,14-dioxo-1,5,8,12-tetrazabicyclo[10.2.2]hexadecan-5-yl)propanenitrile.
| Compound Name | 3-(13,14-dioxo-1,5,8,12-tetrazabicyclo[10.2.2]hexadecan-5-yl)propanenitrile |
|---|---|
| PubChem CID | 10686180 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 3-(13,14-dioxo-1,5,8,12-tetrazabicyclo[10.2.2]hexadecan-5-yl)propanenitrile |
| SMILES | N#CCCN1CCCN2CCN(CCCNCC1)C(=O)C2=O |
| InChI | InChI=1S/C15H25N5O2/c16-4-1-7-18-8-3-10-20-13-12-19(14(21)15(20)22)9-2-5-17-6-11-18/h17H,1-3,5-13H2 |
| InChIKey | GRHQQHFIFMYBNB-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|