About ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate
ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate (PubChem CID 10686265) has the molecular formula C17H24O3S
and a molecular weight of 308.44 g/mol. Its IUPAC name is ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate |
| PubChem CID | 10686265 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@@]1(O)CCCC[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O3S/c1-3-20-16(18)12-17(19)11-5-4-6-15(17)21-14-9-7-13(2)8-10-14/h7-10,15,19H,3-6,11-12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | OPWCCGPZFHTUPB-RDJZCZTQSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate?
The IUPAC name of ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate (CID 10686265) is ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate.
What is the SMILES notation for ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate?
The canonical SMILES for ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate is CCOC(=O)C[C@@]1(O)CCCC[C@@H]1Sc1ccc(C)cc1.
What is the InChIKey of ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate?
The InChIKey is OPWCCGPZFHTUPB-RDJZCZTQSA-N. The full InChI is InChI=1S/C17H24O3S/c1-3-20-16(18)12-17(19)11-5-4-6-15(17)21-14-9-7-13(2)8-10-14/h7-10,15,19H,3-6,11-12H2,1-2H3/t15-,17-/m0/s1.
What are the key properties of ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate?
ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate has a molecular weight of 308.44 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1S,2S)-1-hydroxy-2-(4-methylphenyl)sulfanylcyclohexyl]acetate is sourced from PubChem (CID 10686265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).