C18H30S2 — CID 10686441
1,4-bis(3-methylbutylsulfanylmethyl)benzene (PubChem CID 10686441) has the molecular formula C18H30S2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1,4-bis(3-methylbutylsulfanylmethyl)benzene.
| Compound Name | 1,4-bis(3-methylbutylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 10686441 |
| Molecular Formula | C18H30S2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1,4-bis(3-methylbutylsulfanylmethyl)benzene |
| SMILES | CC(C)CCSCc1ccc(CSCCC(C)C)cc1 |
| InChI | InChI=1S/C18H30S2/c1-15(2)9-11-19-13-17-5-7-18(8-6-17)14-20-12-10-16(3)4/h5-8,15-16H,9-14H2,1-4H3 |
| InChIKey | WVOYYQWKQLYTFK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|