C36H45N3O3S3 — CID 139880662
2,4,6-tris(4-benzylsulfanylbutan-2-yloxy)-1,3,5-triazine (PubChem CID 139880662) has the molecular formula C36H45N3O3S3 and a molecular weight of 663.98 g/mol. Its IUPAC name is 2,4,6-tris(4-benzylsulfanylbutan-2-yloxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-benzylsulfanylbutan-2-yloxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 139880662 |
| Molecular Formula | C36H45N3O3S3 |
| Molecular Weight | 663.98 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | 2,4,6-tris(4-benzylsulfanylbutan-2-yloxy)-1,3,5-triazine |
| SMILES | CC(CCSCc1ccccc1)Oc1nc(OC(C)CCSCc2ccccc2)nc(OC(C)CCSCc2ccccc2)n1 |
| InChI | InChI=1S/C36H45N3O3S3/c1-28(19-22-43-25-31-13-7-4-8-14-31)40-34-37-35(41-29(2)20-23-44-26-32-15-9-5-10-16-32)39-36(38-34)42-30(3)21-24-45-27-33-17-11-6-12-18-33/h4-18,28-30H,19-27H2,1-3H3 |
| InChIKey | KBROLAXXDRMTCH-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.98 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|