C30H33N3O3S3 — CID 139880663
2,4,6-tris(2-benzylsulfanylethoxy)-1,3,5-triazine (PubChem CID 139880663) has the molecular formula C30H33N3O3S3 and a molecular weight of 579.81 g/mol. Its IUPAC name is 2,4,6-tris(2-benzylsulfanylethoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2-benzylsulfanylethoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 139880663 |
| Molecular Formula | C30H33N3O3S3 |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 2,4,6-tris(2-benzylsulfanylethoxy)-1,3,5-triazine |
| SMILES | c1ccc(CSCCOc2nc(OCCSCc3ccccc3)nc(OCCSCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C30H33N3O3S3/c1-4-10-25(11-5-1)22-37-19-16-34-28-31-29(35-17-20-38-23-26-12-6-2-7-13-26)33-30(32-28)36-18-21-39-24-27-14-8-3-9-15-27/h1-15H,16-24H2 |
| InChIKey | SWUFZXTVHCDWBD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|