C23H27N3O3S2 — CID 139880686
4,6-bis[2-[(4-methylphenyl)methylsulfanyl]ethoxy]-1H-1,3,5-triazin-2-one (PubChem CID 139880686) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4,6-bis[2-[(4-methylphenyl)methylsulfanyl]ethoxy]-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-bis[2-[(4-methylphenyl)methylsulfanyl]ethoxy]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 139880686 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4,6-bis[2-[(4-methylphenyl)methylsulfanyl]ethoxy]-1H-1,3,5-triazin-2-one |
| SMILES | Cc1ccc(CSCCOc2nc(OCCSCc3ccc(C)cc3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C23H27N3O3S2/c1-17-3-7-19(8-4-17)15-30-13-11-28-22-24-21(27)25-23(26-22)29-12-14-31-16-20-9-5-18(2)6-10-20/h3-10H,11-16H2,1-2H3,(H,24,25,26,27) |
| InChIKey | GBFXAXOFFLVRJT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|