C14H17ClO2 — CID 106865766
2-(2-chloro-4-methylphenyl)-1-(2-methyloxolan-3-yl)ethanone (PubChem CID 106865766) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-(2-methyloxolan-3-yl)ethanone.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-(2-methyloxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 106865766 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-(2-methyloxolan-3-yl)ethanone |
| SMILES | Cc1ccc(CC(=O)C2CCOC2C)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClO2/c1-9-3-4-11(13(15)7-9)8-14(16)12-5-6-17-10(12)2/h3-4,7,10,12H,5-6,8H2,1-2H3 |
| InChIKey | OLZQUAUXNCJFLV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |