C16H21ClO2 — CID 106870915
2-[(2-chloro-4-methylphenyl)methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 106870915) has the molecular formula C16H21ClO2 and a molecular weight of 280.79 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenyl)methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-chloro-4-methylphenyl)methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106870915 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.79 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(2-chloro-4-methylphenyl)methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(CC2CC(C)CCC2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClO2/c1-10-4-6-14(16(18)19)13(7-10)9-12-5-3-11(2)8-15(12)17/h3,5,8,10,13-14H,4,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | HDUAGFXGUKUCSR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |