C15H18ClFO2 — CID 81021366
2-[(2-chloro-6-fluorophenyl)methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 81021366) has the molecular formula C15H18ClFO2 and a molecular weight of 284.76 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021366 |
| Molecular Formula | C15H18ClFO2 |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)C(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C15H18ClFO2/c1-9-5-6-11(15(18)19)10(7-9)8-12-13(16)3-2-4-14(12)17/h2-4,9-11H,5-8H2,1H3,(H,18,19) |
| InChIKey | OIEJRMCACNJZQZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |