C17H18ClNO — CID 106866608
2-(2-chloro-4-methylphenyl)-1-(2,3-dihydro-1H-indol-7-yl)ethanol (PubChem CID 106866608) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-(2,3-dihydro-1H-indol-7-yl)ethanol.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-(2,3-dihydro-1H-indol-7-yl)ethanol |
|---|---|
| PubChem CID | 106866608 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-(2,3-dihydro-1H-indol-7-yl)ethanol |
| SMILES | Cc1ccc(CC(O)c2cccc3c2NCC3)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClNO/c1-11-5-6-13(15(18)9-11)10-16(20)14-4-2-3-12-7-8-19-17(12)14/h2-6,9,16,19-20H,7-8,10H2,1H3 |
| InChIKey | GOXWYNOVFOIJKR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |