C15H24ClN — CID 106869681
4-(2-chloro-4-methylphenyl)-3-methyl-N-propan-2-ylbutan-2-amine (PubChem CID 106869681) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is 4-(2-chloro-4-methylphenyl)-3-methyl-N-propan-2-ylbutan-2-amine.
| Compound Name | 4-(2-chloro-4-methylphenyl)-3-methyl-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 106869681 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(2-chloro-4-methylphenyl)-3-methyl-N-propan-2-ylbutan-2-amine |
| SMILES | Cc1ccc(CC(C)C(C)NC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClN/c1-10(2)17-13(5)12(4)9-14-7-6-11(3)8-15(14)16/h6-8,10,12-13,17H,9H2,1-5H3 |
| InChIKey | SBIAUTDCMHIIRP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |