C13H17ClO2 — CID 106870599
[3-[(2-chloro-4-methylphenyl)methyl]oxolan-3-yl]methanol (PubChem CID 106870599) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is [3-[(2-chloro-4-methylphenyl)methyl]oxolan-3-yl]methanol.
| Compound Name | [3-[(2-chloro-4-methylphenyl)methyl]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 106870599 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | [3-[(2-chloro-4-methylphenyl)methyl]oxolan-3-yl]methanol |
| SMILES | Cc1ccc(CC2(CO)CCOC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClO2/c1-10-2-3-11(12(14)6-10)7-13(8-15)4-5-16-9-13/h2-3,6,15H,4-5,7-9H2,1H3 |
| InChIKey | UZCPTLQRFQKSKV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |