C14H18BrCl — CID 106870728
1-(3-bromo-2-cyclopropyl-2-methylpropyl)-2-chloro-4-methylbenzene (PubChem CID 106870728) has the molecular formula C14H18BrCl and a molecular weight of 301.65 g/mol. Its IUPAC name is 1-(3-bromo-2-cyclopropyl-2-methylpropyl)-2-chloro-4-methylbenzene.
| Compound Name | 1-(3-bromo-2-cyclopropyl-2-methylpropyl)-2-chloro-4-methylbenzene |
|---|---|
| PubChem CID | 106870728 |
| Molecular Formula | C14H18BrCl |
| Molecular Weight | 301.65 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-(3-bromo-2-cyclopropyl-2-methylpropyl)-2-chloro-4-methylbenzene |
| SMILES | Cc1ccc(CC(C)(CBr)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18BrCl/c1-10-3-4-11(13(16)7-10)8-14(2,9-15)12-5-6-12/h3-4,7,12H,5-6,8-9H2,1-2H3 |
| InChIKey | GTCWTHKCRICZPM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|