C16H31NO2 — CID 106874852
1-[1-(aminomethyl)-3-ethylcyclohexyl]-2-methoxycyclohexan-1-ol (PubChem CID 106874852) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2-methoxycyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2-methoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 106874852 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-2-methoxycyclohexan-1-ol |
| SMILES | CCC1CCCC(CN)(C2(O)CCCCC2OC)C1 |
| InChI | InChI=1S/C16H31NO2/c1-3-13-7-6-9-15(11-13,12-17)16(18)10-5-4-8-14(16)19-2/h13-14,18H,3-12,17H2,1-2H3 |
| InChIKey | BLAPCCIBBHQMRH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |