C17H33NO — CID 79124222
1-[1-(aminomethyl)cycloheptyl]-4-ethylcycloheptan-1-ol (PubChem CID 79124222) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cycloheptyl]-4-ethylcycloheptan-1-ol.
| Compound Name | 1-[1-(aminomethyl)cycloheptyl]-4-ethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 79124222 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-[1-(aminomethyl)cycloheptyl]-4-ethylcycloheptan-1-ol |
| SMILES | CCC1CCCC(O)(C2(CN)CCCCCC2)CC1 |
| InChI | InChI=1S/C17H33NO/c1-2-15-8-7-12-17(19,13-9-15)16(14-18)10-5-3-4-6-11-16/h15,19H,2-14,18H2,1H3 |
| InChIKey | UHHCHLIMFBLBSW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |