C19H37NO — CID 80610748
1-[1-(aminomethyl)cyclooctyl]-4-propan-2-ylcycloheptan-1-ol (PubChem CID 80610748) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclooctyl]-4-propan-2-ylcycloheptan-1-ol.
| Compound Name | 1-[1-(aminomethyl)cyclooctyl]-4-propan-2-ylcycloheptan-1-ol |
|---|---|
| PubChem CID | 80610748 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | 1-[1-(aminomethyl)cyclooctyl]-4-propan-2-ylcycloheptan-1-ol |
| SMILES | CC(C)C1CCCC(O)(C2(CN)CCCCCCC2)CC1 |
| InChI | InChI=1S/C19H37NO/c1-16(2)17-9-8-13-19(21,14-10-17)18(15-20)11-6-4-3-5-7-12-18/h16-17,21H,3-15,20H2,1-2H3 |
| InChIKey | BOUGQRWQYYVVEH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |