About N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine
N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine (PubChem CID 106875227) has the molecular formula C16H20BrN3O
and a molecular weight of 350.26 g/mol. Its IUPAC name is N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine |
| PubChem CID | 106875227 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine |
| SMILES | COc1ccc(N(CCCN)c2nccc(C)c2Br)cc1 |
| InChI | InChI=1S/C16H20BrN3O/c1-12-8-10-19-16(15(12)17)20(11-3-9-18)13-4-6-14(21-2)7-5-13/h4-8,10H,3,9,11,18H2,1-2H3 |
| InChIKey | CFHUSAINRVMEHL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine?
The IUPAC name of N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine (CID 106875227) is N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine.
What is the SMILES notation for N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine?
The canonical SMILES for N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine is COc1ccc(N(CCCN)c2nccc(C)c2Br)cc1.
What is the InChIKey of N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine?
The InChIKey is CFHUSAINRVMEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrN3O/c1-12-8-10-19-16(15(12)17)20(11-3-9-18)13-4-6-14(21-2)7-5-13/h4-8,10H,3,9,11,18H2,1-2H3.
What are the key properties of N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine?
N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine has a molecular weight of 350.26 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-bromo-4-methyl-2-pyridinyl)-N'-(4-methoxyphenyl)propane-1,3-diamine is sourced from PubChem (CID 106875227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).