C12H11N7 — CID 106878720
6-(3-phenyltriazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 106878720) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is 6-(3-phenyltriazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(3-phenyltriazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106878720 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-(3-phenyltriazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(-c2cnnn2-c2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C12H11N7/c13-11-6-9(16-12(14)17-11)10-7-15-18-19(10)8-4-2-1-3-5-8/h1-7H,(H4,13,14,16,17) |
| InChIKey | BQZMSXNIILGPPO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |