C13H13N7O — CID 114691062
4-ethoxy-6-(3-phenyltriazol-4-yl)-1,3,5-triazin-2-amine (PubChem CID 114691062) has the molecular formula C13H13N7O and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-ethoxy-6-(3-phenyltriazol-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(3-phenyltriazol-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114691062 |
| Molecular Formula | C13H13N7O |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-ethoxy-6-(3-phenyltriazol-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(-c2cnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C13H13N7O/c1-2-21-13-17-11(16-12(14)18-13)10-8-15-19-20(10)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H2,14,16,17,18) |
| InChIKey | CNEFYHWUYJPIBV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |