C12H16BrClN2 — CID 106879069
3-bromo-N-(3-chloro-2,2-dimethylcyclobutyl)-4-methylpyridin-2-amine (PubChem CID 106879069) has the molecular formula C12H16BrClN2 and a molecular weight of 303.63 g/mol. Its IUPAC name is 3-bromo-N-(3-chloro-2,2-dimethylcyclobutyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(3-chloro-2,2-dimethylcyclobutyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106879069 |
| Molecular Formula | C12H16BrClN2 |
| Molecular Weight | 303.63 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-bromo-N-(3-chloro-2,2-dimethylcyclobutyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(NC2CC(Cl)C2(C)C)c1Br |
| InChI | InChI=1S/C12H16BrClN2/c1-7-4-5-15-11(10(7)13)16-9-6-8(14)12(9,2)3/h4-5,8-9H,6H2,1-3H3,(H,15,16) |
| InChIKey | AXWZJVUBHIXRDW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|