C18H22O6 — CID 10688134
[(E,2R)-1-[(2S,3R)-3-hydroxyoxan-2-yl]-5-methoxy-5-oxopent-3-en-2-yl] benzoate (PubChem CID 10688134) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(E,2R)-1-[(2S,3R)-3-hydroxyoxan-2-yl]-5-methoxy-5-oxopent-3-en-2-yl] benzoate.
| Compound Name | [(E,2R)-1-[(2S,3R)-3-hydroxyoxan-2-yl]-5-methoxy-5-oxopent-3-en-2-yl] benzoate |
|---|---|
| PubChem CID | 10688134 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(E,2R)-1-[(2S,3R)-3-hydroxyoxan-2-yl]-5-methoxy-5-oxopent-3-en-2-yl] benzoate |
| SMILES | COC(=O)/C=C/[C@@H](C[C@@H]1OCCC[C@H]1O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O6/c1-22-17(20)10-9-14(12-16-15(19)8-5-11-23-16)24-18(21)13-6-3-2-4-7-13/h2-4,6-7,9-10,14-16,19H,5,8,11-12H2,1H3/b10-9+/t14-,15+,16-/m0/s1 |
| InChIKey | MIGLUYABUMJZJG-OLLMXWKRSA-N |
| XLogP | 1.87 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|