C18H20FNO — CID 106883112
2-(4-aminophenyl)-1-(2-fluoro-4,6-dimethylphenyl)-2-methylpropan-1-one (PubChem CID 106883112) has the molecular formula C18H20FNO and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-(2-fluoro-4,6-dimethylphenyl)-2-methylpropan-1-one.
| Compound Name | 2-(4-aminophenyl)-1-(2-fluoro-4,6-dimethylphenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 106883112 |
| Molecular Formula | C18H20FNO |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(4-aminophenyl)-1-(2-fluoro-4,6-dimethylphenyl)-2-methylpropan-1-one |
| SMILES | Cc1cc(C)c(C(=O)C(C)(C)c2ccc(N)cc2)c(F)c1 |
| InChI | InChI=1S/C18H20FNO/c1-11-9-12(2)16(15(19)10-11)17(21)18(3,4)13-5-7-14(20)8-6-13/h5-10H,20H2,1-4H3 |
| InChIKey | IFGXZULKTYPULV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|