C17H17F2NO — CID 107514971
2-(4-aminophenyl)-1-(2,3-difluoro-4-methylphenyl)-2-methylpropan-1-one (PubChem CID 107514971) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-(2,3-difluoro-4-methylphenyl)-2-methylpropan-1-one.
| Compound Name | 2-(4-aminophenyl)-1-(2,3-difluoro-4-methylphenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 107514971 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(4-aminophenyl)-1-(2,3-difluoro-4-methylphenyl)-2-methylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)(C)c2ccc(N)cc2)c(F)c1F |
| InChI | InChI=1S/C17H17F2NO/c1-10-4-9-13(15(19)14(10)18)16(21)17(2,3)11-5-7-12(20)8-6-11/h4-9H,20H2,1-3H3 |
| InChIKey | GXQUPLHOXLKSDO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|