C19H18N2O4 — CID 10688384
3,3-dimethoxy-1-[(3-methoxyphenyl)methyl]-2-oxoindole-5-carbonitrile (PubChem CID 10688384) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3,3-dimethoxy-1-[(3-methoxyphenyl)methyl]-2-oxoindole-5-carbonitrile.
| Compound Name | 3,3-dimethoxy-1-[(3-methoxyphenyl)methyl]-2-oxoindole-5-carbonitrile |
|---|---|
| PubChem CID | 10688384 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3,3-dimethoxy-1-[(3-methoxyphenyl)methyl]-2-oxoindole-5-carbonitrile |
| SMILES | COc1cccc(CN2C(=O)C(OC)(OC)c3cc(C#N)ccc32)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-23-15-6-4-5-14(9-15)12-21-17-8-7-13(11-20)10-16(17)19(24-2,25-3)18(21)22/h4-10H,12H2,1-3H3 |
| InChIKey | WILKFUBDESMTKB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|