C15H23FN2S2 — CID 106884464
[(5,6-dimethyl-1,4-dithian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methyl]hydrazine (PubChem CID 106884464) has the molecular formula C15H23FN2S2 and a molecular weight of 314.50 g/mol. Its IUPAC name is [(5,6-dimethyl-1,4-dithian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methyl]hydrazine.
| Compound Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106884464 |
| Molecular Formula | C15H23FN2S2 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(2-fluoro-4,6-dimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)C2CSC(C)C(C)S2)c(F)c1 |
| InChI | InChI=1S/C15H23FN2S2/c1-8-5-9(2)14(12(16)6-8)15(18-17)13-7-19-10(3)11(4)20-13/h5-6,10-11,13,15,18H,7,17H2,1-4H3 |
| InChIKey | CGQBKNLIHRWGPZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|