C18H28O6 — CID 10688516
[(4R,5R)-2,2-dimethyl-5-(5-oxo-2H-furan-3-yl)-1,3-dioxolan-4-yl]methyl octanoate (PubChem CID 10688516) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-5-(5-oxo-2H-furan-3-yl)-1,3-dioxolan-4-yl]methyl octanoate.
| Compound Name | [(4R,5R)-2,2-dimethyl-5-(5-oxo-2H-furan-3-yl)-1,3-dioxolan-4-yl]methyl octanoate |
|---|---|
| PubChem CID | 10688516 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-5-(5-oxo-2H-furan-3-yl)-1,3-dioxolan-4-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1OC(C)(C)O[C@@H]1C1=CC(=O)OC1 |
| InChI | InChI=1S/C18H28O6/c1-4-5-6-7-8-9-15(19)22-12-14-17(24-18(2,3)23-14)13-10-16(20)21-11-13/h10,14,17H,4-9,11-12H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | MLTGEVRWVLBJPP-RHSMWYFYSA-N |
| XLogP | 2.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|