C8H8BrNO4 — CID 106885916
(3R)-3-(3-bromofuran-2-yl)-3-formamidopropanoic acid (PubChem CID 106885916) has the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. Its IUPAC name is (3R)-3-(3-bromofuran-2-yl)-3-formamidopropanoic acid.
| Compound Name | (3R)-3-(3-bromofuran-2-yl)-3-formamidopropanoic acid |
|---|---|
| PubChem CID | 106885916 |
| Molecular Formula | C8H8BrNO4 |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | (3R)-3-(3-bromofuran-2-yl)-3-formamidopropanoic acid |
| SMILES | O=CN[C@H](CC(=O)O)c1occc1Br |
| InChI | InChI=1S/C8H8BrNO4/c9-5-1-2-14-8(5)6(10-4-11)3-7(12)13/h1-2,4,6H,3H2,(H,10,11)(H,12,13)/t6-/m1/s1 |
| InChIKey | QAYAYEVXWCLYML-ZCFIWIBFSA-N |
| XLogP | 1.30 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|