C13H15NO3 — CID 106888051
[3-(2,6-dimethoxyphenyl)furan-2-yl]methanamine (PubChem CID 106888051) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is [3-(2,6-dimethoxyphenyl)furan-2-yl]methanamine.
| Compound Name | [3-(2,6-dimethoxyphenyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 106888051 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [3-(2,6-dimethoxyphenyl)furan-2-yl]methanamine |
| SMILES | COc1cccc(OC)c1-c1ccoc1CN |
| InChI | InChI=1S/C13H15NO3/c1-15-10-4-3-5-11(16-2)13(10)9-6-7-17-12(9)8-14/h3-7H,8,14H2,1-2H3 |
| InChIKey | LQYQMKPGTZYUOK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |