C14H16Cl2N2S — CID 106890474
2,6-dichloro-1-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzene-1,4-diamine (PubChem CID 106890474) has the molecular formula C14H16Cl2N2S and a molecular weight of 315.27 g/mol. Its IUPAC name is 2,6-dichloro-1-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890474 |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2,6-dichloro-1-N-[1-(5-methylthiophen-2-yl)propan-2-yl]benzene-1,4-diamine |
| SMILES | Cc1ccc(CC(C)Nc2c(Cl)cc(N)cc2Cl)s1 |
| InChI | InChI=1S/C14H16Cl2N2S/c1-8(5-11-4-3-9(2)19-11)18-14-12(15)6-10(17)7-13(14)16/h3-4,6-8,18H,5,17H2,1-2H3 |
| InChIKey | MHAVBTGZGBPTTE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|