C15H19N — CID 106892741
cyclopenten-1-yl(2,3-dihydro-1H-inden-2-yl)methanamine (PubChem CID 106892741) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is cyclopenten-1-yl(2,3-dihydro-1H-inden-2-yl)methanamine.
| Compound Name | cyclopenten-1-yl(2,3-dihydro-1H-inden-2-yl)methanamine |
|---|---|
| PubChem CID | 106892741 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | cyclopenten-1-yl(2,3-dihydro-1H-inden-2-yl)methanamine |
| SMILES | NC(C1=CCCC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H19N/c16-15(11-5-1-2-6-11)14-9-12-7-3-4-8-13(12)10-14/h3-5,7-8,14-15H,1-2,6,9-10,16H2 |
| InChIKey | PEGVBLQLTHWSHR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|