C18H14O2 — CID 106893049
1-benzofuran-3-yl(2,3-dihydro-1H-inden-2-yl)methanone (PubChem CID 106893049) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-benzofuran-3-yl(2,3-dihydro-1H-inden-2-yl)methanone.
| Compound Name | 1-benzofuran-3-yl(2,3-dihydro-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 106893049 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-benzofuran-3-yl(2,3-dihydro-1H-inden-2-yl)methanone |
| SMILES | O=C(c1coc2ccccc12)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H14O2/c19-18(14-9-12-5-1-2-6-13(12)10-14)16-11-20-17-8-4-3-7-15(16)17/h1-8,11,14H,9-10H2 |
| InChIKey | WSQMBVHIRMLVNJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |