C15H14O2 — CID 106893079
2,3-dihydro-1H-inden-2-yl-(5-methylfuran-3-yl)methanone (PubChem CID 106893079) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl-(5-methylfuran-3-yl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-2-yl-(5-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 106893079 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl-(5-methylfuran-3-yl)methanone |
| SMILES | Cc1cc(C(=O)C2Cc3ccccc3C2)co1 |
| InChI | InChI=1S/C15H14O2/c1-10-6-14(9-17-10)15(16)13-7-11-4-2-3-5-12(11)8-13/h2-6,9,13H,7-8H2,1H3 |
| InChIKey | GQYWEDPODYTRMM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |